CAS 71337-52-5 appears in our catalog under these names: 2,2'-(Succinylbis(oxy))bis(3,5-dibromobenzoic acid), 97%, Bis(3,5-dibromosalicyl) succinate, 1,4-Bis(4,6-dibromo-2-carboxyphenyl) butanedioate. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 10000mg, 5000mg, Get quote.
3,5-dibromo-2-[4-(2,4-dibromo-6-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid (CAS 71337-52-5) is a chemical compound with the molecular formula C18H10Br4O8 and a molecular weight of 673.9 g/mol. IUPAC name: 3,5-dibromo-2-[4-(2,4-dibromo-6-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid. InChIKey: MRDWEURGLFYDAO-UHFFFAOYSA-N.
| Molecular formula | C18H10Br4O8 |
|---|---|
| Molecular weight | 673.9 g/mol |
| IUPAC name | 3,5-dibromo-2-[4-(2,4-dibromo-6-carboxyphenoxy)-4-oxobutanoyl]oxybenzoic acid |
| InChIKey | MRDWEURGLFYDAO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)OC(=O)CCC(=O)OC2=C(C=C(C=C2Br)Br)C(=O)O)Br)Br |
Computed by PubChem (NCBI)