CAS 713542-04-2 is the registry number for 1,3,5-Tri(anthracen-9-yl)benzene (contains ~20% inorganics), >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
9-[3,5-di(anthracen-9-yl)phenyl]anthracene (CAS 713542-04-2) is a chemical compound with the molecular formula C48H30 and a molecular weight of 606.7 g/mol. IUPAC name: 9-[3,5-di(anthracen-9-yl)phenyl]anthracene. InChIKey: RDVXPHSOVKZCBJ-UHFFFAOYSA-N.
| Molecular formula | C48H30 |
|---|---|
| Molecular weight | 606.7 g/mol |
| IUPAC name | 9-[3,5-di(anthracen-9-yl)phenyl]anthracene |
| InChIKey | RDVXPHSOVKZCBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C4=CC(=CC(=C4)C5=C6C=CC=CC6=CC7=CC=CC=C75)C8=C9C=CC=CC9=CC1=CC=CC=C18 |
Computed by PubChem (NCBI)