CAS 71360-06-0 appears in our catalog under these names: Bis(3,5–dimethylphenyl)phosphine, Bis(3,5-dimethylphenyl)phosphine, Bis(3,5-diMephenyl)phosphine (10wt% in hexanes). Offered by: GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 50g, 500MG.
Bis(3,5-dimethylphenyl)phosphane (CAS 71360-06-0) is a chemical compound with the molecular formula C16H19P and a molecular weight of 242.29 g/mol. IUPAC name: bis(3,5-dimethylphenyl)phosphane. InChIKey: GPFIUEZTNRNFGD-UHFFFAOYSA-N.
| Molecular formula | C16H19P |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | bis(3,5-dimethylphenyl)phosphane |
| InChIKey | GPFIUEZTNRNFGD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)PC2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)