CAS 71368-80-4 appears in our catalog under these names: 8-Bromo-1-methyl-6-phenyl-4H-s-triazolo(4,3-a)(1,4)benzodiazepine, >95% (HPLC), Bromazolam, 8-Bromo-1-methyl-6-phenyl-4H-S-triazolo(4,3-a)(1,4)benzodiazepine. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 10mg, 2,5mg, 25mg, 1mg, 5mg, 0,1g, 0,05g, 0,25g.
8-bromo-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (CAS 71368-80-4) is a chemical compound with the molecular formula C17H13BrN4 and a molecular weight of 353.2 g/mol. IUPAC name: 8-bromo-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. InChIKey: KCEIOBKDDQAYCM-UHFFFAOYSA-N.
| Molecular formula | C17H13BrN4 |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | 8-bromo-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| InChIKey | KCEIOBKDDQAYCM-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Br)C(=NC2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)