CAS 71384-45-7 is the registry number for 4-Hydroxy-1,3-benzenedisulfonic Acid Disodium, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
Disodium;4-hydroxybenzene-1,3-disulfonate (CAS 71384-45-7) is a chemical compound with the molecular formula C6H4Na2O7S2 and a molecular weight of 298.2 g/mol. IUPAC name: disodium;4-hydroxybenzene-1,3-disulfonate. InChIKey: NGUUTWLPISUTEZ-UHFFFAOYSA-L.
| Molecular formula | C6H4Na2O7S2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | disodium;4-hydroxybenzene-1,3-disulfonate |
| InChIKey | NGUUTWLPISUTEZ-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)