Products 7139-63-1
CAS 7139-63-1 is the registry number for 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trifluoracetamido-D-glucose. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3,4,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (CAS 7139-63-1) is a chemical compound with the molecular formula C16H20F3NO10 and a molecular weight of 443.33 g/mol. IUPAC name: [3,4,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate. InChIKey: XSSGVGGOUZKLAR-UHFFFAOYSA-N.
| Molecular formula | C16H20F3NO10 |
|---|---|
| Molecular weight | 443.33 g/mol |
| IUPAC name | [3,4,6-triacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| InChIKey | XSSGVGGOUZKLAR-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)C(F)(F)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)