CAS 71412-18-5 is the registry number for 3,3'-Thiobis(tetrahydrothiophene 1,1-dioxide), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxothiolan-3-yl)sulfanylthiolane 1,1-dioxide (CAS 71412-18-5) is a chemical compound with the molecular formula C8H14O4S3 and a molecular weight of 270.4 g/mol. IUPAC name: 3-(1,1-dioxothiolan-3-yl)sulfanylthiolane 1,1-dioxide. InChIKey: VRWOOWOJPSQXHK-UHFFFAOYSA-N.
| Molecular formula | C8H14O4S3 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 3-(1,1-dioxothiolan-3-yl)sulfanylthiolane 1,1-dioxide |
| InChIKey | VRWOOWOJPSQXHK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1SC2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)