CAS 71417-19-1 is the registry number for Deltamethrin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 71417-19-1) is a chemical compound with the molecular formula C10H12ClF3O2 and a molecular weight of 256.65 g/mol. IUPAC name: methyl 3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: ZRLLIXSRKOMDAU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF3O2 |
|---|---|
| Molecular weight | 256.65 g/mol |
| IUPAC name | methyl 3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | ZRLLIXSRKOMDAU-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)OC)C=C(C(F)(F)F)Cl)C |
Computed by PubChem (NCBI)