CAS 714220-73-2 is the registry number for 7-Chloro Loxapine. Offered by: TRC. Available pack sizes: 5g.
2,8-dichloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (CAS 714220-73-2) is a chemical compound with the molecular formula C18H17Cl2N3O and a molecular weight of 362.2 g/mol. IUPAC name: 2,8-dichloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine. InChIKey: DOCIUEIFZJXDJU-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl2N3O |
|---|---|
| Molecular weight | 362.2 g/mol |
| IUPAC name | 2,8-dichloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| InChIKey | DOCIUEIFZJXDJU-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=C(C=C3)Cl)OC4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)