Products 71424-95-8

CAS 71424-95-8 is the registry number for 3–Methyl–GABA. Offered by: GLPBio. Available pack sizes: 10mg, 50mg.

Structural formula: {0} (CAS {1})

Bis(4-amino-3-methylbutanoic acid);naphthalene-1,5-disulfonic acid (CAS 71424-95-8) is a chemical compound with the molecular formula C20H30N2O10S2 and a molecular weight of 522.6 g/mol. IUPAC name: bis(4-amino-3-methylbutanoic acid);naphthalene-1,5-disulfonic acid. InChIKey: XDPUYXWLPXNCDY-UHFFFAOYSA-N.

Identity
Molecular formulaC20H30N2O10S2
Molecular weight522.6 g/mol
IUPAC namebis(4-amino-3-methylbutanoic acid);naphthalene-1,5-disulfonic acid
InChIKeyXDPUYXWLPXNCDY-UHFFFAOYSA-N
SMILESCC(CC(=O)O)CN.CC(CC(=O)O)CN.C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)S(=O)(=O)O

Computed by PubChem (NCBI)