CAS 714260-38-5 appears in our catalog under these names: {[(2-chloro-6-fluorophenyl)methyl]sulfanyl}acetic acid, 95%, 2-((2-Chloro-6-fluorophenyl)methylsulphanyl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetic acid (CAS 714260-38-5) is a chemical compound with the molecular formula C9H8ClFO2S and a molecular weight of 234.68 g/mol. IUPAC name: 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetic acid. InChIKey: CCGYUPNKDSPQBG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2S |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetic acid |
| InChIKey | CCGYUPNKDSPQBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CSCC(=O)O)F |
Computed by PubChem (NCBI)