CAS 7144-37-8 appears in our catalog under these names: Copper(II) tosylate 98%, CU(OTS)2, Copper(II) tosylate, 95%, 95%, Benzenesulfonic acid, 4-methyl-, copper(2+) salt (2:1), 95%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
Copper bis(4-methylbenzenesulfonate) (CAS 7144-37-8) is a chemical compound with the molecular formula C14H14CuO6S2 and a molecular weight of 405.9 g/mol. IUPAC name: copper bis(4-methylbenzenesulfonate). InChIKey: MRYMYQPDGZIGDM-UHFFFAOYSA-L.
| Molecular formula | C14H14CuO6S2 |
|---|---|
| Molecular weight | 405.9 g/mol |
| IUPAC name | copper bis(4-methylbenzenesulfonate) |
| InChIKey | MRYMYQPDGZIGDM-UHFFFAOYSA-L |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].CC1=CC=C(C=C1)S(=O)(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)