CAS 71441-09-3 appears in our catalog under these names: Arotinoid Ethyl Ester, Arotinoid, 99.55%. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 10mM/1mL, 50 mg, 5 mg, 10 mg, 25 mg, 100 mg.
Ethyl 4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoate (CAS 71441-09-3) is a chemical compound with the molecular formula C26H32O2 and a molecular weight of 376.5 g/mol. IUPAC name: ethyl 4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoate. InChIKey: NULUAKSYPPSJCO-FBMGVBCBSA-N.
| Molecular formula | C26H32O2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | ethyl 4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoate |
| InChIKey | NULUAKSYPPSJCO-FBMGVBCBSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)/C=C(\C)/C2=CC3=C(C=C2)C(CCC3(C)C)(C)C |
Computed by PubChem (NCBI)