CAS 71484-85-0 appears in our catalog under these names: 4-Nitrophenyl alpha-d-glucuronide, 95%, 4-Nitrophenyl α-D-glucuronide, (2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-(4-nitrophenoxy)tetrahydro-2H-pyran-2-carboxylic acid, 4-Nitrophenyl α-D-Glucuronide. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, 5mg, 50 mg, 25 mg.
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid (CAS 71484-85-0) is a chemical compound with the molecular formula C12H13NO9 and a molecular weight of 315.23 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid. InChIKey: QSUILVWOWLUOEU-LIJGXYGRSA-N.
| Molecular formula | C12H13NO9 |
|---|---|
| Molecular weight | 315.23 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid |
| InChIKey | QSUILVWOWLUOEU-LIJGXYGRSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)