CAS 715-60-6 is the registry number for 1-Pentafluorophenyl-2-thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2,3,4,5,6-pentafluorophenyl)thiourea (CAS 715-60-6) is a chemical compound with the molecular formula C7H3F5N2S and a molecular weight of 242.17 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl)thiourea. InChIKey: YKRHDLIKBWNPJI-UHFFFAOYSA-N.
| Molecular formula | C7H3F5N2S |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl)thiourea |
| InChIKey | YKRHDLIKBWNPJI-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)NC(=S)N |
Computed by PubChem (NCBI)