CAS 71532-40-6 is the registry number for 9-Fluorenylmethyl tosylate. Offered by: TRC. Available pack sizes: 10g.
9H-fluoren-9-ylmethyl 4-methylbenzenesulfonate (CAS 71532-40-6) is a chemical compound with the molecular formula C21H18O3S and a molecular weight of 350.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 4-methylbenzenesulfonate. InChIKey: IAUVDQGKZHZCQI-UHFFFAOYSA-N.
| Molecular formula | C21H18O3S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 4-methylbenzenesulfonate |
| InChIKey | IAUVDQGKZHZCQI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)