CAS 71535-97-2 is the registry number for 2,2’,4,4’-Tetranitrobenzophenone. Offered by: TRC. Available pack sizes: 250mg.
Bis(2,4-dinitrophenyl)methanone (CAS 71535-97-2) is a chemical compound with the molecular formula C13H6N4O9 and a molecular weight of 362.21 g/mol. IUPAC name: bis(2,4-dinitrophenyl)methanone. InChIKey: FAFWLBOSKDZHKI-UHFFFAOYSA-N.
| Molecular formula | C13H6N4O9 |
|---|---|
| Molecular weight | 362.21 g/mol |
| IUPAC name | bis(2,4-dinitrophenyl)methanone |
| InChIKey | FAFWLBOSKDZHKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)