CAS 7158-70-5 appears in our catalog under these names: D-Leucrose, 95%, Leucrose, 95%, Leucrose, D-Leucrose, D-Leucrose, min. 95 %, 50 mg. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Roth. Available pack sizes: 5g, 1g, 25g, 250mg, 0,1g, 0,05g, 0,25g, 0,5g.
(3S,4S,5R)-1,3,4,6-tetrahydroxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one (CAS 7158-70-5) is a chemical compound with the molecular formula C12H22O11 and a molecular weight of 342.30 g/mol. IUPAC name: (3S,4S,5R)-1,3,4,6-tetrahydroxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one. InChIKey: DXALOGXSFLZLLN-WTZPKTTFSA-N.
| Molecular formula | C12H22O11 |
|---|---|
| Molecular weight | 342.30 g/mol |
| IUPAC name | (3S,4S,5R)-1,3,4,6-tetrahydroxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one |
| InChIKey | DXALOGXSFLZLLN-WTZPKTTFSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@H](CO)[C@H]([C@@H](C(=O)CO)O)O)O)O)O)O |
Computed by PubChem (NCBI)