CAS 71585-40-5 is the registry number for 2,2',3,3',4,4',5-Heptachlorodiphenyl Ether. Offered by: TRC. Available pack sizes: 25mg.
1,2,3,4-tetrachloro-5-(2,3,4-trichlorophenoxy)benzene (CAS 71585-40-5) is a chemical compound with the molecular formula C12H3Cl7O and a molecular weight of 411.3 g/mol. IUPAC name: 1,2,3,4-tetrachloro-5-(2,3,4-trichlorophenoxy)benzene. InChIKey: BLBURLWSCHSPIS-UHFFFAOYSA-N.
| Molecular formula | C12H3Cl7O |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5-(2,3,4-trichlorophenoxy)benzene |
| InChIKey | BLBURLWSCHSPIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC2=CC(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)