Products 71589-26-9
CAS 71589-26-9 appears in our catalog under these names: hydroquinone-d6, Hydroquinone-d6, 98 atom % D, min 98% Chemical Purity, hydroquinone–D6. Offered by: Chemat Brand, CDN, GLPBio. Available pack sizes: on request, 1g, 0,5g, 10mg, 250mg, 50mg.
1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene (CAS 71589-26-9) is a chemical compound with the molecular formula C6H6O2 and a molecular weight of 116.15 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene. InChIKey: QIGBRXMKCJKVMJ-UDDMDDBKSA-N.
| Molecular formula | C6H6O2 |
|---|---|
| Molecular weight | 116.15 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene |
| InChIKey | QIGBRXMKCJKVMJ-UDDMDDBKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1O[2H])[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)