CAS 71592-16-0 appears in our catalog under these names: Potassium 2,2,3,3-tetrafluoropropionate, 95%, Potassium 2,2,3,3-tetrafluoropropionate. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg, 25mg.
Potassium 2,2,3,3-tetrafluoropropanoate (CAS 71592-16-0) is a chemical compound with the molecular formula C3HF4KO2 and a molecular weight of 184.13 g/mol. IUPAC name: potassium 2,2,3,3-tetrafluoropropanoate. InChIKey: JCMUVGLPXQXZFM-UHFFFAOYSA-M.
| Molecular formula | C3HF4KO2 |
|---|---|
| Molecular weight | 184.13 g/mol |
| IUPAC name | potassium 2,2,3,3-tetrafluoropropanoate |
| InChIKey | JCMUVGLPXQXZFM-UHFFFAOYSA-M |
| SMILES | C(C(C(=O)[O-])(F)F)(F)F.[K+] |
Computed by PubChem (NCBI)