CAS 716-74-5 appears in our catalog under these names: 2,4-Diaminopteridine-6-carboxylic acid, 95%, Pralatrexate Impurity 1, 2,4-Diaminopteridine-6-carboxylicAcid, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 1g, 250mg, on request, 100mg, 10mg, 50mg.
2,4-diaminopteridine-6-carboxylic acid (CAS 716-74-5) is a chemical compound with the molecular formula C7H6N6O2 and a molecular weight of 206.16 g/mol. IUPAC name: 2,4-diaminopteridine-6-carboxylic acid. InChIKey: CXVOUUFGXQVMMB-UHFFFAOYSA-N.
| Molecular formula | C7H6N6O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | 2,4-diaminopteridine-6-carboxylic acid |
| InChIKey | CXVOUUFGXQVMMB-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=NC(=NC2=N1)N)N)C(=O)O |
Computed by PubChem (NCBI)