CAS 71606-34-3 is the registry number for (S)-5-Bromonicoltine. Offered by: TRC. Available pack sizes: 100mg.
3-bromo-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 71606-34-3) is a chemical compound with the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. IUPAC name: 3-bromo-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: VKHLFAFBADEABG-JTQLQIEISA-N.
| Molecular formula | C10H13BrN2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | 3-bromo-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | VKHLFAFBADEABG-JTQLQIEISA-N |
| SMILES | CN1CCC[C@H]1C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)