CAS 71617-10-2 appears in our catalog under these names: Isoamyl 4-Methoxycinnamate, >95% (HPLC), 4-Methoxycinnamic acid-isoamyl ester, Amiloxate, Isoamyl 4-Methoxycinnamate, >95.0%(GC), Amiloxate 96% (isomers mixture). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Ambeed. Available pack sizes: 10g, 1g, 250mg, 100mg, 5g, 25g, 100g, 500g.
3-methylbutyl 3-(4-methoxyphenyl)prop-2-enoate (CAS 71617-10-2) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 3-methylbutyl 3-(4-methoxyphenyl)prop-2-enoate. InChIKey: UBNYRXMKIIGMKK-UHFFFAOYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 3-methylbutyl 3-(4-methoxyphenyl)prop-2-enoate |
| InChIKey | UBNYRXMKIIGMKK-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)C=CC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)