Products 7163-50-0
CAS 7163-50-0 appears in our catalog under these names: (4-Methylphenyl)(oxo)acetic acid, 96%, (4-Methylphenyl)(oxo)acetic acid, 2-Oxo-2-(p-tolyl)acetic acid, 95%, 95%, (4-Methylphenyl)glyoxylic acid, 96%, 2-Oxo-2-(p-tolyl)acetic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 2,5g, 100mg, 250mg, 15g, 25g.
2-(4-methylphenyl)-2-oxoacetic acid (CAS 7163-50-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 2-(4-methylphenyl)-2-oxoacetic acid. InChIKey: UIIIPQVTXBPHTI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 2-(4-methylphenyl)-2-oxoacetic acid |
| InChIKey | UIIIPQVTXBPHTI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Methylbenzoylformic acid, para-Methylbenzoylformic acid, (4-Methylphenyl)(oxo)acetic acid, 2-(4-methylphenyl)-2-oxoacetic acid, 2-Oxo-2-(p-tolyl)acetic acid, (4-Methylphenyl)glyoxylic acid, 4-methylphenylglyoxylic acid, Benzeneacetic acid, 4-methyl-alpha-oxo-, Benzeneacetic acid,4-methyl-a-oxo-, 2-oxo-2-p-tolylacetic acid