Products 71636-62-9
CAS 71636-62-9 is the registry number for SKF-80723. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-bromo-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide (CAS 71636-62-9) is a chemical compound with the molecular formula C16H17Br2NO2 and a molecular weight of 415.12 g/mol. IUPAC name: 9-bromo-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide. InChIKey: NYAMJPQXUKPMIX-UHFFFAOYSA-N.
| Molecular formula | C16H17Br2NO2 |
|---|---|
| Molecular weight | 415.12 g/mol |
| IUPAC name | 9-bromo-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide |
| InChIKey | NYAMJPQXUKPMIX-UHFFFAOYSA-N |
| SMILES | C1CNCC(C2=CC(=C(C(=C21)Br)O)O)C3=CC=CC=C3.Br |
Computed by PubChem (NCBI)