Products 716362-32-2
CAS 716362-32-2 appears in our catalog under these names: 4-(Cyclopropylamino)-2,2-dimethyl-4-oxobutanoic acid, 95%, 95%, 4-(Cyclopropylamino)-2,2-dimethyl-4-oxobutanoic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(cyclopropylamino)-2,2-dimethyl-4-oxobutanoic acid (CAS 716362-32-2) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 4-(cyclopropylamino)-2,2-dimethyl-4-oxobutanoic acid. InChIKey: SBJVZVZMIPSWMQ-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-(cyclopropylamino)-2,2-dimethyl-4-oxobutanoic acid |
| InChIKey | SBJVZVZMIPSWMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)NC1CC1)C(=O)O |
Computed by PubChem (NCBI)