CAS 71669-26-6 is the registry number for Triclosan Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,9-tetrachlorodibenzo-p-dioxin (CAS 71669-26-6) is a chemical compound with the molecular formula C12H4Cl4O2 and a molecular weight of 322.0 g/mol. IUPAC name: 1,2,3,9-tetrachlorodibenzo-p-dioxin. InChIKey: CMVHZKSHSHQJHS-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl4O2 |
|---|---|
| Molecular weight | 322.0 g/mol |
| IUPAC name | 1,2,3,9-tetrachlorodibenzo-p-dioxin |
| InChIKey | CMVHZKSHSHQJHS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC3=C(C(=C(C=C3O2)Cl)Cl)Cl |
Computed by PubChem (NCBI)