CAS 71686-01-6 appears in our catalog under these names: Calcium 2-oxoglutarate, 95%, Calcium 2-Oxoglutarate, >95% (HPLC), Calcium 2–oxoglutarate, Calcium 2-oxoglutarate 98% HPLC/T, Pentanedioic acid, 2-oxo-, calcium salt (1:1), 98% HPLC/T, 98% HPLC/T. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1kg, 500g, 100g, 25g, 1g, 500mg, 100mg.
Calcium 2-oxopentanedioate (CAS 71686-01-6) is a chemical compound with the molecular formula C5H4CaO5 and a molecular weight of 184.16 g/mol. IUPAC name: calcium 2-oxopentanedioate. InChIKey: LADYPAWUSNPKJF-UHFFFAOYSA-L.
| Molecular formula | C5H4CaO5 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | calcium 2-oxopentanedioate |
| InChIKey | LADYPAWUSNPKJF-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)