Products 717104-43-3
CAS 717104-43-3 is the registry number for AXT-914. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(4-bromophenyl)methyl]-4-(4-propan-2-ylphenyl)-6-prop-2-ynoxyquinazolin-2-one (CAS 717104-43-3) is a chemical compound with the molecular formula C27H23BrN2O2 and a molecular weight of 487.4 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]-4-(4-propan-2-ylphenyl)-6-prop-2-ynoxyquinazolin-2-one. InChIKey: KIZITKARUSPCHY-UHFFFAOYSA-N.
| Molecular formula | C27H23BrN2O2 |
|---|---|
| Molecular weight | 487.4 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]-4-(4-propan-2-ylphenyl)-6-prop-2-ynoxyquinazolin-2-one |
| InChIKey | KIZITKARUSPCHY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NC(=O)N(C3=C2C=C(C=C3)OCC#C)CC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)