CAS 71731-58-3 appears in our catalog under these names: Tiquizium Bromide, >95% (HPLC), Tiquizium (bromide). Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, Get quote.
(5R,9aR)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium bromide (CAS 71731-58-3) is a chemical compound with the molecular formula C19H24BrNS2 and a molecular weight of 410.4 g/mol. IUPAC name: (5R,9aR)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium bromide. InChIKey: VKBNGRDAHSELMQ-KYSFMIDTSA-M.
| Molecular formula | C19H24BrNS2 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | (5R,9aR)-7-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,8,9,9a-octahydroquinolizin-5-ium bromide |
| InChIKey | VKBNGRDAHSELMQ-KYSFMIDTSA-M |
| SMILES | C[N@+]12CCCC[C@@H]1CCC(=C(C3=CC=CS3)C4=CC=CS4)C2.[Br-] |
Computed by PubChem (NCBI)