CAS 71735-32-5 is the registry number for 1-(Pentafluoropropionyl)imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2,2,3,3,3-pentafluoro-1-imidazol-1-ylpropan-1-one (CAS 71735-32-5) is a chemical compound with the molecular formula C6H3F5N2O and a molecular weight of 214.09 g/mol. IUPAC name: 2,2,3,3,3-pentafluoro-1-imidazol-1-ylpropan-1-one. InChIKey: VZUSRIIEPFQBNE-UHFFFAOYSA-N.
| Molecular formula | C6H3F5N2O |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 2,2,3,3,3-pentafluoro-1-imidazol-1-ylpropan-1-one |
| InChIKey | VZUSRIIEPFQBNE-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)