CAS 71822-19-0 appears in our catalog under these names: γ–D–Glutamylglycine (trifluoroacetate salt), gamma-DGG (TFA), 99.95%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 250mg, 50mg, 100 mg, 25 mg, 50 mg, 10 mg.
(2R)-2-amino-5-(carboxymethylamino)-5-oxopentanoic acid;2,2,2-trifluoroacetic acid (CAS 71822-19-0) is a chemical compound with the molecular formula C9H13F3N2O7 and a molecular weight of 318.20 g/mol. IUPAC name: (2R)-2-amino-5-(carboxymethylamino)-5-oxopentanoic acid;2,2,2-trifluoroacetic acid. InChIKey: UBOUYYUIWKVKPI-PGMHMLKASA-N.
| Molecular formula | C9H13F3N2O7 |
|---|---|
| Molecular weight | 318.20 g/mol |
| IUPAC name | (2R)-2-amino-5-(carboxymethylamino)-5-oxopentanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | UBOUYYUIWKVKPI-PGMHMLKASA-N |
| SMILES | C(CC(=O)NCC(=O)O)[C@H](C(=O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)