CAS 71848-87-8 appears in our catalog under these names: Indomethacin Impurity 9, Indometacin 1-Glycerin Ester, Indomethacin Impurity 11, Indomethacin 1-Glycerin Ester, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,3-dihydroxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 71848-87-8) is a chemical compound with the molecular formula C22H22ClNO6 and a molecular weight of 431.9 g/mol. IUPAC name: 2,3-dihydroxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: AXVIECLQBNZXKG-UHFFFAOYSA-N.
| Molecular formula | C22H22ClNO6 |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | 2,3-dihydroxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | AXVIECLQBNZXKG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC(CO)O |
Computed by PubChem (NCBI)