CAS 718603-61-3 is the registry number for N-(2-Methoxy-5-nitrophenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetic acid (CAS 718603-61-3) is a chemical compound with the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. IUPAC name: 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetic acid. InChIKey: VWVSDQXAMIZDFN-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O7S |
|---|---|
| Molecular weight | 304.28 g/mol |
| IUPAC name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetic acid |
| InChIKey | VWVSDQXAMIZDFN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])N(CC(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)