Products 718603-61-3

CAS 718603-61-3 is the registry number for N-(2-Methoxy-5-nitrophenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetic acid (CAS 718603-61-3) is a chemical compound with the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. IUPAC name: 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetic acid. InChIKey: VWVSDQXAMIZDFN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O7S
Molecular weight304.28 g/mol
IUPAC name2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetic acid
InChIKeyVWVSDQXAMIZDFN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)[N+](=O)[O-])N(CC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)