CAS 718613-20-8 appears in our catalog under these names: 1,4’-Bipiperidine-2,2,3,3,4,4,5,5,6,6-d10, 1,4'-Bipiperidine-d10. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
2,2,3,3,4,4,5,5,6,6-decadeuterio-1-piperidin-4-ylpiperidine (CAS 718613-20-8) is a chemical compound with the molecular formula C10H20N2 and a molecular weight of 178.34 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-piperidin-4-ylpiperidine. InChIKey: QDVBKXJMLILLLB-YRRFPNITSA-N.
| Molecular formula | C10H20N2 |
|---|---|
| Molecular weight | 178.34 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-piperidin-4-ylpiperidine |
| InChIKey | QDVBKXJMLILLLB-YRRFPNITSA-N |
| SMILES | [2H]C1(C(C(N(C(C1([2H])[2H])([2H])[2H])C2CCNCC2)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)