CAS 71866-86-9 appears in our catalog under these names: 4,4''-Diethynyl-5'-(4-ethynylphenyl)-1,1':3',1''-terphenyl, 95%, 4,4''–Diethynyl–5'–(4–ethynylphenyl)–1,1':3',1''–terphenyl, 4,4''-Diethynyl-5'-(4-ethynylphenyl)-1,1':3',1''-terphenyl, 97%, 97%, 4,4''-Diethynyl-5'-(4-ethynylphenyl)-1,1':3',1''-terphenyl, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 100mg, 1g, 10g, 25g.
1,3,5-tris(4-ethynylphenyl)benzene (CAS 71866-86-9) is a chemical compound with the molecular formula C30H18 and a molecular weight of 378.5 g/mol. IUPAC name: 1,3,5-tris(4-ethynylphenyl)benzene. InChIKey: XJIJQOFZIULKCI-UHFFFAOYSA-N.
| Molecular formula | C30H18 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 1,3,5-tris(4-ethynylphenyl)benzene |
| InChIKey | XJIJQOFZIULKCI-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)C#C)C4=CC=C(C=C4)C#C |
Computed by PubChem (NCBI)