CAS 71922-95-7 is the registry number for Fludoxopone Dihydrochloride. Offered by: TRC. Available pack sizes: 500mg.
4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;dihydrochloride (CAS 71922-95-7) is a chemical compound with the molecular formula C21H23Cl2FN2O3 and a molecular weight of 441.3 g/mol. IUPAC name: 4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;dihydrochloride. InChIKey: OTOHQQXGSVLDIS-UHFFFAOYSA-N.
| Molecular formula | C21H23Cl2FN2O3 |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;dihydrochloride |
| InChIKey | OTOHQQXGSVLDIS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=C(OC(=O)O2)C3=CC=C(C=C3)F)C4=CC=CC=C4.Cl.Cl |
Computed by PubChem (NCBI)