CAS 719300-59-1 appears in our catalog under these names: Olanzapine EP Impurity C, Olanzapine Impurity 3(Olanzapine EP Impurity C), N-Chloromethyl Olanzapine Chloride, >95% (HPLC), Olanzapine EP Impurity C (as Chloride), N–Chloromethyl Olanzapine Chloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
4-[4-(chloromethyl)-4-methylpiperazin-4-ium-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine chloride (CAS 719300-59-1) is a chemical compound with the molecular formula C18H22Cl2N4S and a molecular weight of 397.4 g/mol. IUPAC name: 4-[4-(chloromethyl)-4-methylpiperazin-4-ium-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine chloride. InChIKey: OAWSYANWHZMKRV-UHFFFAOYSA-M.
| Molecular formula | C18H22Cl2N4S |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 4-[4-(chloromethyl)-4-methylpiperazin-4-ium-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine chloride |
| InChIKey | OAWSYANWHZMKRV-UHFFFAOYSA-M |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N4CC[N+](CC4)(C)CCl.[Cl-] |
Computed by PubChem (NCBI)