Products 71989-97-4
CAS 71989-97-4 appears in our catalog under these names: 3-(3,4,5-Trimethoxyphenyl)acrylic anhydride, 97%, 3,4,5-Trimethoxycinnamic acid anhydride, 95%, 3,4,5-Trimethoxycinnamic acid anhydride. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 25g, 1g, 10g, 5g, 2g.
[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (CAS 71989-97-4) is a chemical compound with the molecular formula C24H26O9 and a molecular weight of 458.5 g/mol. IUPAC name: [(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate. InChIKey: IACNKWPFTWDNDK-FIFLTTCUSA-N.
| Molecular formula | C24H26O9 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | [(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| InChIKey | IACNKWPFTWDNDK-FIFLTTCUSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)OC(=O)/C=C/C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)