Products 72007-92-2

CAS 72007-92-2 is the registry number for 4,4'-Dithiobisphenylbutyric Acid. Offered by: TRC. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-[4-[[4-(3-carboxypropyl)phenyl]disulfanyl]phenyl]butanoic acid (CAS 72007-92-2) is a chemical compound with the molecular formula C20H22O4S2 and a molecular weight of 390.5 g/mol. IUPAC name: 4-[4-[[4-(3-carboxypropyl)phenyl]disulfanyl]phenyl]butanoic acid. InChIKey: LGKRJINEBZYLPW-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22O4S2
Molecular weight390.5 g/mol
IUPAC name4-[4-[[4-(3-carboxypropyl)phenyl]disulfanyl]phenyl]butanoic acid
InChIKeyLGKRJINEBZYLPW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCCC(=O)O)SSC2=CC=C(C=C2)CCCC(=O)O

Computed by PubChem (NCBI)