CAS 72023-79-1 appears in our catalog under these names: 5-Bromo-4-nitrobenzo[c][1,2,5]thiadiazole, 95%, 5–Bromo–4–nitrobenzo(c)(1,2,5)thiadiazole, 5-Bromo-4-nitrobenzo[c][1,2,5]thiadiazole, 95%, 95%, 5-Bromo-4-nitrobenzo[c][1,2,5]thiadiazole, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g.
5-bromo-4-nitro-2,1,3-benzothiadiazole (CAS 72023-79-1) is a chemical compound with the molecular formula C6H2BrN3O2S and a molecular weight of 260.07 g/mol. IUPAC name: 5-bromo-4-nitro-2,1,3-benzothiadiazole. InChIKey: BPYYEVZFVMMYSS-UHFFFAOYSA-N.
| Molecular formula | C6H2BrN3O2S |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | 5-bromo-4-nitro-2,1,3-benzothiadiazole |
| InChIKey | BPYYEVZFVMMYSS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)