CAS 7204-55-9 is the registry number for 2,2′-Dithiobis[4-(1,1-dimethylpropyl)phenol], 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg.
2-[[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]disulfanyl]-4-(2-methylbutan-2-yl)phenol (CAS 7204-55-9) is a chemical compound with the molecular formula C22H30O2S2 and a molecular weight of 390.6 g/mol. IUPAC name: 2-[[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]disulfanyl]-4-(2-methylbutan-2-yl)phenol. InChIKey: RZAPFEWZXAKCHZ-UHFFFAOYSA-N.
| Molecular formula | C22H30O2S2 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | 2-[[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]disulfanyl]-4-(2-methylbutan-2-yl)phenol |
| InChIKey | RZAPFEWZXAKCHZ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1)O)SSC2=C(C=CC(=C2)C(C)(C)CC)O |
Computed by PubChem (NCBI)