Products 7205-90-5

CAS 7205-90-5 is the registry number for Chloromethyl 4-chlorophenyl sulfide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

1-chloro-4-(chloromethylsulfanyl)benzene (CAS 7205-90-5) is a chemical compound with the molecular formula C7H6Cl2S and a molecular weight of 193.09 g/mol. IUPAC name: 1-chloro-4-(chloromethylsulfanyl)benzene. InChIKey: XPJUCMIJGVAEGF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2S
Molecular weight193.09 g/mol
IUPAC name1-chloro-4-(chloromethylsulfanyl)benzene
InChIKeyXPJUCMIJGVAEGF-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1SCCl)Cl

Computed by PubChem (NCBI)