CAS 720685-14-3 is the registry number for Dopamine Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(4-hydroxyphenyl)butan-2-yl]-2,3-dihydroindole-5,6-dione (CAS 720685-14-3) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 1-[4-(4-hydroxyphenyl)butan-2-yl]-2,3-dihydroindole-5,6-dione. InChIKey: YMKANOIZRMDMIZ-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 1-[4-(4-hydroxyphenyl)butan-2-yl]-2,3-dihydroindole-5,6-dione |
| InChIKey | YMKANOIZRMDMIZ-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=C(C=C1)O)N2CCC3=CC(=O)C(=O)C=C32 |
Computed by PubChem (NCBI)