CAS 720710-30-5 appears in our catalog under these names: L-Thyroxine-13C6, 98% 98%atom%13C, L–Thyroxine–13C6, L-Thyroxine-13C6, 91.0%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 100μg, 100 μg.
(2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl](113C)propanoic acid (CAS 720710-30-5) is a chemical compound with the molecular formula C15H11I4NO4 and a molecular weight of 777.86 g/mol. IUPAC name: (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl](113C)propanoic acid. InChIKey: XUIIKFGFIJCVMT-XXOGGYJESA-N.
| Molecular formula | C15H11I4NO4 |
|---|---|
| Molecular weight | 777.86 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl](113C)propanoic acid |
| InChIKey | XUIIKFGFIJCVMT-XXOGGYJESA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)C[C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)