CAS 7210-27-7 is the registry number for 2-(Cyanomethyl)indole. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-(1H-indol-2-yl)acetonitrile (CAS 7210-27-7) is a chemical compound with the molecular formula C10H8N2 and a molecular weight of 156.18 g/mol. IUPAC name: 2-(1H-indol-2-yl)acetonitrile. InChIKey: RORMSTAFXZRNGK-UHFFFAOYSA-N.
| Molecular formula | C10H8N2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | 2-(1H-indol-2-yl)acetonitrile |
| InChIKey | RORMSTAFXZRNGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)CC#N |
Computed by PubChem (NCBI)