CAS 72111-57-0 appears in our catalog under these names: 5-Chloropyrazine-2,3-dicarbonitrile, 97%, 5-Chloropyrazine-2,3-dicarbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5-chloropyrazine-2,3-dicarbonitrile (CAS 72111-57-0) is a chemical compound with the molecular formula C6HClN4 and a molecular weight of 164.55 g/mol. IUPAC name: 5-chloropyrazine-2,3-dicarbonitrile. InChIKey: XMUYZFOAVMMUNE-UHFFFAOYSA-N.
| Molecular formula | C6HClN4 |
|---|---|
| Molecular weight | 164.55 g/mol |
| IUPAC name | 5-chloropyrazine-2,3-dicarbonitrile |
| InChIKey | XMUYZFOAVMMUNE-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C#N)C#N)Cl |
Computed by PubChem (NCBI)