Products 72120-72-0
CAS 72120-72-0 is the registry number for F4-Trp, 99.99%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 50 mg, 100 mg, 25 mg.
(2S)-2-amino-3-(4,5,6,7-tetrafluoro-1H-indol-3-yl)propanoic acid (CAS 72120-72-0) is a chemical compound with the molecular formula C11H8F4N2O2 and a molecular weight of 276.19 g/mol. IUPAC name: (2S)-2-amino-3-(4,5,6,7-tetrafluoro-1H-indol-3-yl)propanoic acid. InChIKey: TVKMKLHCZVODHW-BYPYZUCNSA-N.
| Molecular formula | C11H8F4N2O2 |
|---|---|
| Molecular weight | 276.19 g/mol |
| IUPAC name | (2S)-2-amino-3-(4,5,6,7-tetrafluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | TVKMKLHCZVODHW-BYPYZUCNSA-N |
| SMILES | C1=C(C2=C(N1)C(=C(C(=C2F)F)F)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
4,5,6,7-Tetrafluoro-L-tryptophan, orb3135723