Products 72135-37-6

CAS 72135-37-6 is the registry number for 4-Bromo-2-methoxy-5-sulfamoylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-bromo-2-methoxy-5-sulfamoylbenzoic acid (CAS 72135-37-6) is a chemical compound with the molecular formula C8H8BrNO5S and a molecular weight of 310.12 g/mol. IUPAC name: 4-bromo-2-methoxy-5-sulfamoylbenzoic acid. InChIKey: HPMUHUHXQQFRTF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO5S
Molecular weight310.12 g/mol
IUPAC name4-bromo-2-methoxy-5-sulfamoylbenzoic acid
InChIKeyHPMUHUHXQQFRTF-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)O)S(=O)(=O)N)Br

Computed by PubChem (NCBI)